CAS 865074-55-1
:4-(2-Methylcyclopropyl)pyridine
Description:
4-(2-Methylcyclopropyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of the 2-methylcyclopropyl group at the 4-position of the pyridine ring introduces unique steric and electronic properties, influencing its reactivity and interactions. This compound typically exhibits a colorless to pale yellow liquid form and has a distinct odor. It is soluble in organic solvents, reflecting its non-polar characteristics due to the cyclopropyl group. The nitrogen atom in the pyridine ring contributes to its basicity and potential for forming hydrogen bonds, making it relevant in various chemical reactions and applications, including pharmaceuticals and agrochemicals. Additionally, the compound's structure may allow for specific interactions with biological targets, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H11N
InChI:InChI=1S/C9H11N/c1-7-6-9(7)8-2-4-10-5-3-8/h2-5,7,9H,6H2,1H3
InChI key:InChIKey=PNZKSTJEQXQXGJ-UHFFFAOYSA-N
SMILES:CC1C(C1)C=2C=CN=CC2
Synonyms:- Pyridine, 4-(2-methylcyclopropyl)-
- 4-(2-Methylcyclopropyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
