CAS 865075-04-3

4-[3-(1-Oxido-4-pyridinyl)propyl]pyridine

Description:

4-[3-(1-Oxido-4-pyridinyl)propyl]pyridine, with the CAS number 865075-04-3, is a chemical compound characterized by its pyridine rings and a propyl chain. This compound features a pyridine moiety that is substituted at the 4-position with a propyl group, which is further substituted with a 1-oxidopyridinyl group. The presence of the nitrogen atom in the pyridine rings contributes to its basicity and potential for coordination with metal ions. The compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Its solubility, stability, and reactivity can be influenced by the functional groups present, and it may participate in various chemical reactions typical of nitrogen-containing heterocycles. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Overall, 4-[3-(1-Oxido-4-pyridinyl)propyl]pyridine represents a class of compounds that may have significant applications in both synthetic and medicinal chemistry.

Formula: C₁₃H₁₄N₂O

InChI: InChI=1S/C13H14N2O/c16-15-10-6-13(7-11-15)3-1-2-12-4-8-14-9-5-12/h4-11H,1-3H2

InChI key: InChIKey=ZBYYQQVUXWUWCD-UHFFFAOYSA-N

SMILES: C(CCC=1C=CN=CC1)C=2C=CN(=O)=CC2

Synonyms:

• Pyridine, 4-[3-(1-oxido-4-pyridinyl)propyl]-
• 4-[3-(1-Oxido-4-pyridinyl)propyl]pyridine
• 1-Oxido-4-(3-pyridin-4-ylpropyl)pyridin-1-ium

4-[3-(Pyridin-4-yl)propyl]pyridine 1-oxide

CAS: 865075-04-3

Formula: C₁₃H₁₄N₂O

Molecular weight: 214.268

Ref: 10-F032606