CAS 865075-16-7
:α-(2-Phenylethyl)-4-pyridinemethanol
Description:
α-(2-Phenylethyl)-4-pyridinemethanol, identified by its CAS number 865075-16-7, is an organic compound characterized by its unique structure, which includes a pyridine ring and a phenylethyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential biological activity due to its structural motifs. The presence of the hydroxyl group (-OH) in the methanol portion contributes to its ability to engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the pyridine ring can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound may also exhibit pharmacological properties, making it of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and its applications could range from research in drug development to potential uses in materials science. Overall, α-(2-Phenylethyl)-4-pyridinemethanol represents a versatile compound with significant implications in various fields of chemistry.
Formula:C14H15NO
InChI:InChI=1S/C14H15NO/c16-14(13-8-10-15-11-9-13)7-6-12-4-2-1-3-5-12/h1-5,8-11,14,16H,6-7H2
InChI key:InChIKey=LKRXAUGAEMSWCP-UHFFFAOYSA-N
SMILES:C(CCC1=CC=CC=C1)(O)C=2C=CN=CC2
Synonyms:- 3-Phenyl-1-(pyridin-4-yl)propan-1-ol
- 4-Pyridinemethanol, α-(2-phenylethyl)-
- α-(2-Phenylethyl)-4-pyridinemethanol
- 3-Phenyl-1-pyridin-4-yl-propan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
