CymitQuimica logo

CAS 865075-24-7

:

1,1′-(1,2-Ethanediyl)bis[4-piperidinemethanamine]

Description:
1,1′-(1,2-Ethanediyl)bis[4-piperidinemethanamine], identified by its CAS number 865075-24-7, is a chemical compound characterized by its unique structure, which features two piperidinemethanamine groups linked by an ethanediyl bridge. This compound is typically classified as a diamine due to the presence of two amine functional groups, which can participate in various chemical reactions, including those involving nucleophilic substitution and polymerization. Its piperidine rings contribute to its basicity and potential for forming salts with acids. The compound may exhibit properties such as solubility in polar solvents, and its amine groups can engage in hydrogen bonding, influencing its interactions in biological systems. Additionally, due to its structural features, it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate potential hazards associated with its use.
Formula:C14H30N4
InChI:InChI=1S/C14H30N4/c15-11-13-1-5-17(6-2-13)9-10-18-7-3-14(12-16)4-8-18/h13-14H,1-12,15-16H2
InChI key:InChIKey=JZOBWGSZKPWRPJ-UHFFFAOYSA-N
SMILES:C(CN1CCC(CN)CC1)N2CCC(CN)CC2
Synonyms:
  • 4-Piperidinemethanamine, 1,1′-(1,2-ethanediyl)bis-
  • 1,1′-(1,2-Ethanediyl)bis[4-piperidinemethanamine]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.