CAS 865076-04-6
:4-(4-Pyridinylmethyl)-3,5-morpholinedione
Description:
4-(4-Pyridinylmethyl)-3,5-morpholinedione, identified by its CAS number 865076-04-6, is a chemical compound that features a morpholine ring substituted with two carbonyl groups and a pyridinylmethyl group. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically characterized by its solid state at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the morpholine moiety. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The presence of the pyridine ring may also impart specific electronic properties, influencing its reactivity and interaction with other molecules. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols, as it may possess toxicological properties. Further studies would be necessary to fully elucidate its pharmacological profile and potential uses in various fields, including drug development and chemical synthesis.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c13-9-6-15-7-10(14)12(9)5-8-1-3-11-4-2-8/h1-4H,5-7H2
InChI key:InChIKey=XINWXOPHEFXEAF-UHFFFAOYSA-N
SMILES:C(N1C(=O)COCC1=O)C=2C=CN=CC2
Synonyms:- 4-(4-Pyridinylmethyl)-3,5-morpholinedione
- 3,5-Morpholinedione, 4-(4-pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
