CAS 865076-11-5
:4-Chloro-2-[[4-(tetrahydro-2H-pyran-4-yl)-1-piperidinyl]methyl]phenol
Description:
4-Chloro-2-[[4-(tetrahydro-2H-pyran-4-yl)-1-piperidinyl]methyl]phenol, with the CAS number 865076-11-5, is a chemical compound characterized by its complex structure, which includes a chloro-substituted phenolic moiety and a piperidine ring linked to a tetrahydro-2H-pyran group. This compound typically exhibits properties associated with both phenolic and amine functionalities, which may influence its solubility, reactivity, and biological activity. The presence of the chloro group can enhance its lipophilicity, potentially affecting its pharmacokinetic properties. The tetrahydro-2H-pyran moiety may contribute to the compound's conformational flexibility, impacting its interaction with biological targets. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise values.
Formula:C17H24ClNO2
InChI:InChI=1S/C17H24ClNO2/c18-16-1-2-17(20)15(11-16)12-19-7-3-13(4-8-19)14-5-9-21-10-6-14/h1-2,11,13-14,20H,3-10,12H2
InChI key:InChIKey=AKWDBFFYONMKLI-UHFFFAOYSA-N
SMILES:C(N1CCC(CC1)C2CCOCC2)C3=C(O)C=CC(Cl)=C3
Synonyms:- Phenol, 4-chloro-2-[[4-(tetrahydro-2H-pyran-4-yl)-1-piperidinyl]methyl]-
- 4-Chloro-2-[[4-(tetrahydro-2H-pyran-4-yl)-1-piperidinyl]methyl]phenol
- 4-Chloro-2-((4-(tetrahydro-2H-pyran-4-yl)piperidin-1-yl)methyl)phenol
- 4-CHLORO-2-[4-(TETRAHYDRO-PYRAN-4-YL)-PIPERIDIN-1-YLMETHYL]-PHENOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-2-[4-(tetrahydro-pyran-4-yl)-piperidin-1-ylmethyl]-phenol
CAS:Formula:C17H24ClNO2Molecular weight:309.83
