CAS 865106-54-3

4-(Cyclobutylmethoxy)piperidine

Description:

4-(Cyclobutylmethoxy)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The presence of a cyclobutylmethoxy group at the 4-position of the piperidine ring contributes to its unique properties, including potential steric effects and hydrophobic interactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents, which is common for piperidine derivatives, and may exhibit moderate to low solubility in water due to its hydrophobic cyclobutyl group. The compound may possess biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its structure suggests potential interactions with biological targets, which could be explored in drug discovery. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₉NO

InChI: InChI=1S/C10H19NO/c1-2-9(3-1)8-12-10-4-6-11-7-5-10/h9-11H,1-8H2

InChI key: InChIKey=ROLHXRDTERANGQ-UHFFFAOYSA-N

SMILES: C(OC1CCNCC1)C2CCC2

Synonyms:

• 4-(Cyclobutylmethoxy)piperidine
• Piperidine, 4-(cyclobutylmethoxy)-