CAS 865138-64-3

3-bromo-4-propoxybenzaldehyde

Description:

3-Bromo-4-propoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and a propoxy group attached to a benzaldehyde moiety. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and physical properties, such as its boiling and melting points. The propoxy group, consisting of a propyl chain attached to an ether oxygen, contributes to the compound's hydrophobic characteristics and can affect its solubility in various solvents. This compound is likely to exhibit typical aldehyde reactivity, including the ability to undergo oxidation to form carboxylic acids or participate in nucleophilic addition reactions. Additionally, the bromine substituent can enhance electrophilic aromatic substitution reactions, making it a useful intermediate in organic synthesis. Overall, 3-bromo-4-propoxybenzaldehyde is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science, owing to its unique structural features and reactivity.

Formula: C₁₀H₁₁BrO₂

InChI: InChI=1/C10H11BrO2/c1-2-5-13-10-4-3-8(7-12)6-9(10)11/h3-4,6-7H,2,5H2,1H3

SMILES: CCCOc1ccc(cc1Br)C=O

3-Bromo-4-propoxybenzaldehyde

CAS: 865138-64-3

Formula: C₁₀H₁₁BrO₂

Purity: 95%

Molecular weight: 243.0971

Ref: IN-DA008FTD

3-bromo-4-propoxybenzaldehyde

CAS: 865138-64-3

Formula: C₁₀H₁₁BrO₂

Purity: ≥95%

Molecular weight: 243.1

Ref: 10-F315501

3-bromo-4-propoxybenzaldehyde

CAS: 865138-64-3

Versatile small molecule scaffold

Formula: C₁₀H₁₁BrO₂

Purity: Min. 95%

Molecular weight: 243.1 g/mol

Ref: 3D-QJB13864