CAS 86514-37-6

Carbamic acid, (2-aminophenyl)phenyl-, ethyl ester

Description:

Carbamic acid, (2-aminophenyl)phenyl-, ethyl ester, identified by CAS number 86514-37-6, is an organic compound characterized by its carbamate functional group. This substance features an ethyl ester moiety attached to a carbamic acid structure, which includes a phenyl group and an amino group at the ortho position of the aromatic ring. The presence of the amino group contributes to its potential as a biological active compound, possibly influencing its solubility and reactivity. Typically, carbamates exhibit moderate stability and can undergo hydrolysis in the presence of water, leading to the release of the corresponding amine and alcohol. The compound may also exhibit properties such as being a potential intermediate in organic synthesis or having applications in agrochemicals or pharmaceuticals. Safety data should be consulted for handling and exposure risks, as carbamates can vary in toxicity. Overall, the unique structural features of this compound suggest diverse applications in chemical synthesis and potential biological activity.

Formula: C₁₅H₁₆N₂O₂

InChI: InChI=1S/C15H16N2O2/c1-2-19-15(18)17(12-8-4-3-5-9-12)14-11-7-6-10-13(14)16/h3-11H,2,16H2,1H3

InChI key: InChIKey=VQDKFHKDYVWQCC-UHFFFAOYSA-N

SMILES: N(C(OCC)=O)(C1=C(N)C=CC=C1)C2=CC=CC=C2

Synonyms:

• Carbamic acid, (2-aminophenyl)phenyl-, ethyl ester