CAS 86518-09-4

4-Methoxyfuro[3,2-c]pyridine-2-carboxaldehyde

Description:

4-Methoxyfuro[3,2-c]pyridine-2-carboxaldehyde is a heterocyclic organic compound characterized by its fused furan and pyridine rings, along with a methoxy group and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the methoxy group can influence its reactivity and interaction with biological targets. Additionally, the aldehyde functional group can participate in various chemical reactions, including condensation and oxidation. The compound's unique structure may also impart specific optical properties, making it useful in various applications, including fluorescence studies. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Overall, 4-Methoxyfuro[3,2-c]pyridine-2-carboxaldehyde is a compound of interest for further research in both synthetic and applied chemistry.

Formula: C₉H₇NO₃

InChI: InChI=1S/C9H7NO3/c1-12-9-7-4-6(5-11)13-8(7)2-3-10-9/h2-5H,1H3

InChI key: InChIKey=DUVXCWUBTZMTED-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(OC(C=O)=C2)=CC=N1

Synonyms:

• Furo[3,2-c]pyridine-2-carboxaldehyde, 4-methoxy-
• 4-Methoxyfuro[3,2-c]pyridine-2-carboxaldehyde