
CAS 865204-04-2
:1-Bromo-4-(1-methoxycyclobutyl)benzene
Description:
1-Bromo-4-(1-methoxycyclobutyl)benzene is an organic compound characterized by its aromatic structure, featuring a bromine atom and a methoxy-substituted cyclobutyl group attached to a benzene ring. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The methoxy group enhances the solubility of the compound in organic solvents and can influence its electronic properties, potentially affecting its reactivity and interaction with other molecules. The cyclobutyl moiety contributes to the compound's three-dimensional structure, which may impact its steric properties and overall stability. This compound is of interest in synthetic organic chemistry and may have applications in the development of pharmaceuticals or agrochemicals due to its unique structural features. As with many brominated compounds, it is essential to handle it with care, considering potential environmental and health impacts associated with bromine-containing substances.
Formula:C11H13BrO
InChI:InChI=1S/C11H13BrO/c1-13-11(7-2-8-11)9-3-5-10(12)6-4-9/h3-6H,2,7-8H2,1H3
InChI key:InChIKey=JMPVLOKZTIEMHE-UHFFFAOYSA-N
SMILES:O(C)C1(CCC1)C2=CC=C(Br)C=C2
Synonyms:- 1-Bromo-4-(1-methoxycyclobutyl)benzene
- Benzene, 1-bromo-4-(1-methoxycyclobutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.