CAS 86521-11-1

3-[2-(Trimethylsilyl)ethynyl]isoquinoline

Description:

3-[2-(Trimethylsilyl)ethynyl]isoquinoline is an organic compound characterized by its isoquinoline backbone, which is a bicyclic structure containing a fused benzene and pyridine ring. The presence of the trimethylsilyl group attached to an ethynyl moiety enhances its stability and solubility in organic solvents, making it useful in various synthetic applications. This compound typically exhibits properties such as moderate to high melting and boiling points, depending on the specific conditions and purity. Its unique structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the ethynyl group can participate in further chemical reactions, such as cross-coupling reactions, making it a valuable intermediate in organic chemistry. The trimethylsilyl group also serves as a protecting group for functional groups during synthetic transformations. Overall, 3-[2-(Trimethylsilyl)ethynyl]isoquinoline is a versatile compound with significant implications in chemical research and development.

Formula: C₁₄H₁₅NSi

InChI: InChI=1S/C14H15NSi/c1-16(2,3)9-8-14-10-12-6-4-5-7-13(12)11-15-14/h4-7,10-11H,1-3H3

InChI key: InChIKey=DCTOSPSCGVALNI-UHFFFAOYSA-N

SMILES: C(#C[Si](C)(C)C)C1=CC2=C(C=N1)C=CC=C2

Synonyms:

• Isoquinoline, 3-[2-(trimethylsilyl)ethynyl]-
• 2-Isoquinolin-3-ylethynyl(trimethyl)silane
• Isoquinoline, 3-[(trimethylsilyl)ethynyl]-
• 3-[2-(Trimethylsilyl)ethynyl]isoquinoline
• 3-(Trimethylsilylethynyl)isoquinoline