CymitQuimica logo

CAS 865415-13-0

:

7-Chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid

Description:
7-Chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid is a synthetic organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This compound features a chloro substituent at the 7-position and a methyl group at the 8-position of the quinoline ring, contributing to its unique chemical properties. The presence of a carboxylic acid functional group at the 4-position enhances its acidity and potential for forming salts or esters. Additionally, the compound contains a phenyl group substituted with a 2-methylpropoxy group, which may influence its solubility and biological activity. The overall molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and polar functional groups. Its specific interactions, stability, and reactivity would depend on the surrounding environment and conditions, making it a subject of interest for further research in drug development and related fields.
Formula:C21H20ClNO3
InChI:InChI=1S/C21H20ClNO3/c1-12(2)11-26-15-6-4-14(5-7-15)19-10-17(21(24)25)16-8-9-18(22)13(3)20(16)23-19/h4-10,12H,11H2,1-3H3,(H,24,25)
InChI key:InChIKey=ZDRBCQVLZXVNNI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC(C)C)C=C3)C(C)=C(Cl)C=C2
Synonyms:
  • 7-Chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-4-quinolinecarboxylic acid
  • 4-Quinolinecarboxylic acid, 7-chloro-8-methyl-2-[4-(2-methylpropoxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.