
CAS 865430-76-8
:Levamlodipine hydrochloride
Description:
Levamlodipine hydrochloride is a pharmaceutical compound primarily used as an antihypertensive agent. It is the S-enantiomer of amlodipine, which means it has a specific three-dimensional arrangement that contributes to its pharmacological activity. This compound functions as a calcium channel blocker, inhibiting the influx of calcium ions into vascular smooth muscle and cardiac muscle, leading to vasodilation and a subsequent decrease in blood pressure. Levamlodipine is typically administered in oral form and is known for its long half-life, allowing for once-daily dosing. The hydrochloride salt form enhances its solubility and stability. In terms of physical characteristics, levamlodipine hydrochloride is usually presented as a white to off-white crystalline powder. Its safety profile is generally favorable, but like all medications, it may have side effects, including peripheral edema and palpitations. As with any pharmaceutical, it is essential to use levamlodipine hydrochloride under medical supervision to ensure appropriate dosing and monitoring for potential interactions with other medications.
Formula:C20H25ClN2O5·ClH
InChI:InChI=1S/C20H25ClN2O5.ClH/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;/h5-8,17,23H,4,9-11,22H2,1-3H3;1H/t17-;/m0./s1
InChI key:InChIKey=BSBOZVBRVBLCLO-LMOVPXPDSA-N
SMILES:C(OCC)(=O)C=1[C@H](C(C(OC)=O)=C(C)NC1COCCN)C2=C(Cl)C=CC=C2.Cl
Synonyms:- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, monohydrochloride, (4S)-
- Levamlodipine hydrochloride
- (S)-Amlodipine hydrochloride
- (S)-(-)-Amlodipine hydrochloride
- 3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-1,4-dihydro-6-methyl-, 3-ethyl 5-methyl ester, hydrochloride (1:1), (4S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Levamlodipine hydrochloride
CAS:<p>Levamlodipine hydrochloride is a medication used to lower blood pressure and prevent chest pain.</p>Formula:C20H26Cl2N2O5Color and Shape:SolidMolecular weight:445.34
