CAS 865444-79-7

4-Chloro-5-methylimidazo[5,1-f][1,2,4]triazine

Description:

4-Chloro-5-methylimidazo[5,1-f][1,2,4]triazine is a heterocyclic compound characterized by its fused triazine and imidazole rings, which contribute to its unique chemical properties. This compound features a chlorine atom and a methyl group, which influence its reactivity and solubility. It is typically a crystalline solid at room temperature and may exhibit moderate stability under standard conditions. The presence of the chlorine atom can enhance its electrophilic character, making it potentially reactive in various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry and material science due to its potential biological activities and applications in synthesizing other complex molecules. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in biological systems. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-Chloro-5-methylimidazo[5,1-f][1,2,4]triazine is a compound with notable chemical characteristics that warrant further investigation in research and application contexts.

Formula: C₆H₅ClN₄

InChI: InChI=1S/C6H5ClN4/c1-4-5-6(7)8-2-10-11(5)3-9-4/h2-3H,1H3

InChI key: InChIKey=KUQZKUDARXMPQV-UHFFFAOYSA-N

SMILES: ClC=1C=2N(N=CN1)C=NC2C

Synonyms:

• 4-Chloro-5-[methyl]imidazo[5,1-f][1,2,4]triazine
• Imidazo[5,1-f][1,2,4]triazine, 4-chloro-5-methyl-
• 4-Chloro-5-methylimidazo[5,1-f][1,2,4]triazine

4-CHLORO-5-METHYL-IMIDAZO[5,1-F][1,2,4]TRIAZINE

CAS: 865444-79-7

Formula: C₆H₅ClN₄

Purity: 97%

Molecular weight: 168.58

Ref: 10-F501859

4-Chloro-5-methyl-imidazo[5,1-f][1,2,4]triazine

CAS: 865444-79-7

Versatile small molecule scaffold

Formula: C₆H₅ClN₄

Purity: Min. 95%

Molecular weight: 168.59 g/mol

Ref: 3D-QJB44479