CAS 865444-80-0

Methyl 1-amino-1H-imidazole-5-carboxylate

Description:

Methyl 1-amino-1H-imidazole-5-carboxylate, with the CAS number 865444-80-0, is a chemical compound characterized by its imidazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features an amino group and a carboxylate group, contributing to its potential as a building block in organic synthesis and medicinal chemistry. The presence of the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical reactions. Methyl 1-amino-1H-imidazole-5-carboxylate may exhibit biological activity, potentially serving as a precursor for the synthesis of bioactive molecules or pharmaceuticals. Its reactivity can be attributed to the functional groups present, allowing for various transformations such as acylation or alkylation. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application in laboratory settings. Overall, this compound represents a versatile intermediate in the field of organic chemistry.

Formula: C₅H₇N₃O₂

InChI: InChI=1S/C5H7N3O2/c1-10-5(9)4-2-7-3-8(4)6/h2-3H,6H2,1H3

InChI key: InChIKey=BGPIJVLISHIDFQ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N(N)C=NC1

Synonyms:

• 1H-Imidazole-5-carboxylic acid, 1-amino-, methyl ester
• Methyl 3-amino-3H-imidazole-4-carboxylate
• Methyl 1-amino-1H-imidazole-5-carboxylate
• 3-Amino-3H-imidazole-4-carboxylic acid methyl ester