CAS 86546-87-4
:6-{3-[(carboxyacetyl)oxy]-7-(beta-D-glucopyranosyloxy)-5-hydroxy-4-oxo-4H-chromen-2-yl}-3-hydroxycyclohexa-2,4-dien-1-yl
Description:
The chemical substance known as "6-{3-[(carboxyacetyl)oxy]-7-(beta-D-glucopyranosyloxy)-5-hydroxy-4-oxo-4H-chromen-2-yl}-3-hydroxycyclohexa-2,4-dien-1-yl" with the CAS number 86546-87-4 is a complex organic compound characterized by its chromenone core structure, which is a fused bicyclic system containing a benzene ring and a pyrone. This compound features multiple functional groups, including hydroxyl (-OH), carboxylic acid (-COOH), and glycosyl moieties, which contribute to its potential biological activity and solubility properties. The presence of the beta-D-glucopyranosyl group suggests that it may exhibit glycosidic characteristics, potentially influencing its interaction with biological systems. Additionally, the cyclohexadiene moiety indicates the presence of conjugated double bonds, which may enhance its reactivity and stability. Overall, this compound's structural complexity and functional diversity suggest potential applications in pharmaceuticals or as a bioactive agent, although specific biological activities would require further investigation.
Formula:C24H23O14
InChI:InChI=1/C24H23O14/c25-8-14-18(31)20(33)21(34)24(37-14)35-11-5-12(27)17-13(6-11)36-22(9-1-3-10(26)4-2-9)23(19(17)32)38-16(30)7-15(28)29/h1-6,9,14,18,20-21,24-27,31,33-34H,7-8H2,(H,28,29)/t14-,18-,20+,21-,24-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Apigenin 7-O-malonylglucoside
CAS:Apigenin 7-O-malonylglucosidePurity:≥95%Molecular weight:518.42g/molApigenin 7-O-malonylglucoside
CAS:Apigenin 7-O-malonylglucoside (Apigenin 7-O-(6''-O-malonylglucoside)) is found in chrysanthemums and is a flavonoid as well as a glycoside.Formula:C24H22O13Purity:98.23%Color and Shape:SolidMolecular weight:518.42Apigenin 7-O-(6""-O-malonyl)-β-D-glucoside
CAS:Formula:C24H22O13Purity:95%~99%Molecular weight:518.427Apigenin 7-o-(6''-o-malonylglucoside)
CAS:<p>Apigenin 7-o-(6''-o-malonylglucoside) is a flavonoid glucoside, which is a naturally occurring compound found in a variety of plant sources, including some fruits and vegetables. This compound is structurally derived from apigenin, a well-known flavone, through the attachment of a glucoside moiety modified with a malonyl group.</p>Formula:C24H22O13Purity:Min. 95%Molecular weight:518.42 g/mol



