CAS 865470-86-6

5-[(4-methylpiperazin-1-yl)methyl]furan-2-carboxylic acid

Description:

5-[(4-Methylpiperazin-1-yl)methyl]furan-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and a carboxylic acid functional group. The presence of the 4-methylpiperazine moiety contributes to its potential biological activity, as piperazine derivatives are often explored for their pharmacological properties. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for carboxylic acids. Its molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid group, enhancing its solubility and reactivity. The compound's CAS number, 865470-86-6, allows for easy identification in chemical databases and literature. It may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. As with many organic compounds, proper handling and storage are essential to maintain its stability and efficacy.

Formula: C₁₁H₁₆N₂O₃

InChI: InChI=1/C11H16N2O3/c1-12-4-6-13(7-5-12)8-9-2-3-10(16-9)11(14)15/h2-3H,4-8H2,1H3,(H,14,15)

SMILES: CN1CCN(CC1)Cc1ccc(C(=O)O)o1

5-[(4-methylpiperazin-1-yl)methyl]-2-furoic acid

CAS: 865470-86-6

Formula: C₁₁H₁₆N₂O₃

Purity: 95.0%

Color and Shape: Solid, White powder

Molecular weight: 224.26

Ref: 10-F315641