CAS 86552-32-1

P-(4-Phenylbutyl)phosphinic acid

Description:

P-(4-Phenylbutyl)phosphinic acid is an organophosphorus compound characterized by the presence of a phosphinic acid functional group attached to a phenylbutyl moiety. This compound typically exhibits properties associated with phosphinic acids, such as being a weak acid due to the presence of the phosphinic group, which can donate a proton. The phenylbutyl substituent contributes to its hydrophobic characteristics, potentially influencing its solubility in organic solvents rather than in water. The compound may also exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its structure allows for potential interactions with biological systems, which could lead to applications in drug design or as a biochemical agent. Additionally, the presence of the phenyl group may enhance its stability and reactivity compared to simpler phosphinic acids. As with many organophosphorus compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₀H₁₅O₂P

InChI: InChI=1S/C10H15O2P/c11-13(12)9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7,13H,4-5,8-9H2,(H,11,12)

InChI key: InChIKey=XOVHGRGKNYFTDH-UHFFFAOYSA-N

SMILES: C(CCCP(=O)O)C1=CC=CC=C1

Synonyms:

• (4-Phenylbutyl)Phosphinic Acid
• (4-Phenylbutyl)phosphinicacid
• (4-Phenylbutyl)phosphonous acid
• 4-Phenylbutylphosphonous acid
• 4-phenylbutyl-H-phosphinic acid
• Hydroxy-Oxo-(4-Phenylbutyl)Phosphanium
• P-(4-Phenylbutyl)phosphinic acid
• Phosphinic acid, P-(4-phenylbutyl)-
• Phosphinic acid, (4-phenylbutyl)-