CAS 865604-20-2

4-(3-pyridyl)pyridin-2-amine

Description:

4-(3-pyridyl)pyridin-2-amine, also known by its CAS number 865604-20-2, is a heterocyclic organic compound characterized by the presence of two pyridine rings connected by an amine group. This compound features a pyridine ring substituted at the 2-position with an amino group and at the 4-position with a 3-pyridyl group. It typically exhibits properties such as being a solid at room temperature, with potential applications in medicinal chemistry due to its structural similarity to biologically active compounds. The presence of nitrogen atoms in the pyridine rings contributes to its basicity and potential for forming coordination complexes with metal ions. Additionally, this compound may exhibit interesting pharmacological properties, making it a subject of research in drug development. Its solubility and reactivity can vary depending on the solvent and conditions, which is important for its application in various chemical reactions and formulations.

Formula: C₁₀H₉N₃

InChI: InChI=1/C10H9N3/c11-10-6-8(3-5-13-10)9-2-1-4-12-7-9/h1-7H,(H2,11,13)

SMILES: c1cc(cnc1)c1cc[nH]c(=N)c1

Synonyms:

• [3,4'-Bipyridin]-2'-Amine
• 4-Pyridin-3-ylpyridin-2-amine

[3,4'-Bipyridin]-2'-amine

CAS: 865604-20-2

Formula: C₁₀H₉N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.1986

Ref: IN-DA00IE4E

3,4′-Bipyridin-2′-amine

CAS: 865604-20-2

Formula: C₁₀H₉N₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 171.203

Ref: 10-F064776