CAS 865610-66-8
:5-(chloromethyl)-3-(4-pyridyl)isoxazole
Description:
5-(Chloromethyl)-3-(4-pyridyl)isoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of a chloromethyl group indicates that a chlorine atom is attached to a carbon that is also bonded to a methyl group, enhancing its reactivity and potential for further chemical modifications. The 4-pyridyl group signifies that there is a pyridine ring substituted at the fourth position, contributing to the compound's overall polarity and potential for hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for various interactions with biological targets, and its reactivity can be exploited in synthetic chemistry. As with many heterocyclic compounds, it may possess unique physical and chemical properties, including solubility in organic solvents and stability under certain conditions, which are essential for its application in various chemical and biological contexts.
Formula:C9H7ClN2O
InChI:InChI=1/C9H7ClN2O/c10-6-8-5-9(12-13-8)7-1-3-11-4-2-7/h1-5H,6H2
SMILES:c1cnccc1c1cc(CCl)on1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.