CymitQuimica logo

CAS 865657-78-9

:

4-Methyl-6-(3-methyl-2-thienyl)-2-pyrimidinamine

Description:
4-Methyl-6-(3-methyl-2-thienyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 2 and 4. The presence of a methyl group at the 4-position and a thienyl group at the 6-position contributes to its unique properties. The thienyl group, derived from thiophene, introduces sulfur into the structure, which can influence the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. Its molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, affecting its physical properties such as melting point, boiling point, and solubility in various solvents. Additionally, the presence of multiple functional groups may allow for further chemical modifications, enhancing its utility in synthetic chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H11N3S
InChI:InChI=1S/C10H11N3S/c1-6-3-4-14-9(6)8-5-7(2)12-10(11)13-8/h3-5H,1-2H3,(H2,11,12,13)
InChI key:InChIKey=IKUKXBARAREVFJ-UHFFFAOYSA-N
SMILES:CC1=C(SC=C1)C=2C=C(C)N=C(N)N2
Synonyms:
  • 4-Methyl-6-(3-methyl-2-thienyl)-2-pyrimidinamine
  • 2-Pyrimidinamine, 4-methyl-6-(3-methyl-2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.