CAS 865657-80-3

6-Iodo-2-(3-nitrophenyl)imidazo[1,2-a]pyridine

Description:

6-Iodo-2-(3-nitrophenyl)imidazo[1,2-a]pyridine is a heterocyclic compound characterized by its imidazo[1,2-a]pyridine core, which features a fused ring system containing nitrogen atoms. The presence of an iodine atom at the 6-position and a nitrophenyl group at the 2-position contributes to its unique chemical properties and potential reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent and conditions. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's reactivity and interactions with biological targets. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be subject to various analytical methods such as NMR, mass spectrometry, and chromatography for purity assessment and structural confirmation.

Formula: C₁₃H₈IN₃O₂

InChI: InChI=1S/C13H8IN3O2/c14-10-4-5-13-15-12(8-16(13)7-10)9-2-1-3-11(6-9)17(18)19/h1-8H

InChI key: InChIKey=CLRYLXAWKMAGPK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C2=CN3C(=N2)C=CC(I)=C3)C=CC1

Synonyms:

• 6-Iodo-2-(3-nitrophenyl)imidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 6-iodo-2-(3-nitrophenyl)-