CAS 865657-83-6

4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-methyl-3-butyn-2-ol

Description:

4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-methyl-3-butyn-2-ol, with the CAS number 865657-83-6, is a synthetic organic compound characterized by its complex structure, which includes a pyridine ring substituted with a chlorine atom and a trifluoromethyl group. This compound features a terminal alkyne functional group, specifically a butyn-2-ol moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's unique combination of functional groups suggests potential utility in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its physical properties, such as solubility and boiling point, would depend on the specific interactions of its functional groups. Overall, this compound exemplifies the complexity and versatility of modern synthetic organic chemistry, with potential implications in pharmaceuticals and agrochemicals.

Formula: C₁₁H₉ClF₃NO

InChI: InChI=1S/C11H9ClF3NO/c1-10(2,17)4-3-9-8(12)5-7(6-16-9)11(13,14)15/h5-6,17H,1-2H3

InChI key: InChIKey=QXNOBAYVAIGEDZ-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(Cl)C(C#CC(C)(C)O)=NC1

Synonyms:

• 4-[3-Chloro-5-(trifluoromethyl)-2-pyridinyl]-2-methyl-3-butyn-2-ol
• 3-Butyn-2-ol, 4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-2-methyl-