
CAS 865658-19-1
:4-[[2-Methoxy-4-(2-propen-1-yl)phenoxy]methyl]benzonitrile
Description:
4-[[2-Methoxy-4-(2-propen-1-yl)phenoxy]methyl]benzonitrile, identified by its CAS number 865658-19-1, is an organic compound characterized by its complex structure, which includes a benzonitrile moiety and a methoxy-substituted phenyl group. This compound features a propenyl group, contributing to its potential reactivity and applications in organic synthesis. The presence of the nitrile functional group indicates that it may exhibit polar characteristics, influencing its solubility and interaction with other chemical species. Additionally, the methoxy group can enhance the compound's lipophilicity, potentially affecting its biological activity and pharmacokinetics. The compound's structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its unique combination of functional groups may also allow for various chemical transformations, making it a versatile building block in synthetic organic chemistry. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific environmental conditions and the presence of other reactants.
Formula:C18H17NO2
InChI:InChI=1S/C18H17NO2/c1-3-4-14-9-10-17(18(11-14)20-2)21-13-16-7-5-15(12-19)6-8-16/h3,5-11H,1,4,13H2,2H3
InChI key:InChIKey=UINXYBWAVRKQKV-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(C#N)C=C1)C2=C(OC)C=C(CC=C)C=C2
Synonyms:- 4-[[2-Methoxy-4-(2-propen-1-yl)phenoxy]methyl]benzonitrile
- Benzonitrile, 4-[[2-methoxy-4-(2-propenyl)phenoxy]methyl]-
- Benzonitrile, 4-[[2-methoxy-4-(2-propen-1-yl)phenoxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.