CymitQuimica logo

CAS 865658-36-2

:

2-[2-(Acetyloxy)ethyl]-6-chloro-2H-1,4-benzoxazin-3(4H)-one

Description:
2-[2-(Acetyloxy)ethyl]-6-chloro-2H-1,4-benzoxazin-3(4H)-one, identified by its CAS number 865658-36-2, is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine ring. This compound features an acetyloxy group and a chloro substituent, contributing to its unique chemical properties. Typically, compounds of this class exhibit biological activity, often serving as intermediates in pharmaceutical synthesis or as potential therapeutic agents. The presence of the chloro group can enhance lipophilicity, potentially affecting the compound's solubility and permeability in biological systems. Additionally, the acetyloxy group may influence reactivity and stability, making it a subject of interest in medicinal chemistry. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the functional groups present. Overall, this compound represents a valuable entity in the field of organic chemistry, with potential applications in drug development and other chemical research areas.
Formula:C12H12ClNO4
InChI:InChI=1S/C12H12ClNO4/c1-7(15)17-5-4-11-12(16)14-9-6-8(13)2-3-10(9)18-11/h2-3,6,11H,4-5H2,1H3,(H,14,16)
InChI key:InChIKey=VPUVDUGPIDIIEQ-UHFFFAOYSA-N
SMILES:O=C1NC=2C(OC1CCOC(C)=O)=CC=C(Cl)C2
Synonyms:
  • 2H-1,4-Benzoxazin-3(4H)-one, 2-[2-(acetyloxy)ethyl]-6-chloro-
  • 2-[2-(Acetyloxy)ethyl]-6-chloro-2H-1,4-benzoxazin-3(4H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.