
CAS 865658-81-7
:5-(1,3-Benzodioxol-5-ylmethyl)-3-methyl-2,4-thiazolidinedione
Description:
5-(1,3-Benzodioxol-5-ylmethyl)-3-methyl-2,4-thiazolidinedione, also known by its CAS number 865658-81-7, is a synthetic organic compound characterized by its thiazolidinedione core structure, which is a five-membered ring containing sulfur and nitrogen. This compound features a benzodioxole moiety, contributing to its potential biological activity and pharmacological properties. Thiazolidinediones are known for their role as insulin sensitizers, often studied in the context of diabetes management. The presence of the benzodioxole group may enhance its interaction with biological targets, potentially influencing its efficacy and safety profile. The compound is typically characterized by its molecular weight, solubility in various solvents, and stability under specific conditions. Its synthesis involves multi-step organic reactions, and it may exhibit specific reactivity patterns due to the functional groups present. As with many thiazolidinediones, research into its pharmacodynamics and pharmacokinetics is essential for understanding its therapeutic potential and mechanisms of action.
Formula:C12H11NO4S
InChI:InChI=1S/C12H11NO4S/c1-13-11(14)10(18-12(13)15)5-7-2-3-8-9(4-7)17-6-16-8/h2-4,10H,5-6H2,1H3
InChI key:InChIKey=OWLGSLNXPAPVIC-UHFFFAOYSA-N
SMILES:C(C=1C=C2C(=CC1)OCO2)C3C(=O)N(C)C(=O)S3
Synonyms:- 5-(1,3-Benzodioxol-5-ylmethyl)-3-methyl-2,4-thiazolidinedione
- 2,4-Thiazolidinedione, 5-(1,3-benzodioxol-5-ylmethyl)-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.