CymitQuimica logo

CAS 865658-83-9

:

5-[3-[4-(4-Fluorophenyl)-1-piperazinyl]-1-propyn-1-yl]pyrimidine

Description:
5-[3-[4-(4-Fluorophenyl)-1-piperazinyl]-1-propyn-1-yl]pyrimidine, with the CAS number 865658-83-9, is a chemical compound characterized by its complex structure that includes a pyrimidine ring and a piperazine moiety. This compound features a propynyl substituent that connects the piperazine to the pyrimidine, along with a fluorophenyl group that enhances its pharmacological properties. The presence of the fluorine atom can influence the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various receptors or enzymes. Its structural features suggest potential interactions with biological targets, which may lead to therapeutic applications. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. Overall, this compound exemplifies the intricate design often found in drug development, where modifications to the molecular structure can significantly impact efficacy and selectivity.
Formula:C17H17FN4
InChI:InChI=1S/C17H17FN4/c18-16-3-5-17(6-4-16)22-10-8-21(9-11-22)7-1-2-15-12-19-14-20-13-15/h3-6,12-14H,7-11H2
InChI key:InChIKey=LIGAJXHZWWXOFP-UHFFFAOYSA-N
SMILES:C(C#CC=1C=NC=NC1)N2CCN(CC2)C3=CC=C(F)C=C3
Synonyms:
  • 5-[3-[4-(4-Fluorophenyl)-1-piperazinyl]-1-propyn-1-yl]pyrimidine
  • Pyrimidine, 5-[3-[4-(4-fluorophenyl)-1-piperazinyl]-1-propynyl]-
  • Pyrimidine, 5-[3-[4-(4-fluorophenyl)-1-piperazinyl]-1-propyn-1-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.