CAS 865658-84-0

3,3-Bis[(6-chloro-3-pyridinyl)methyl]-2,4-pentanedione

Description:

3,3-Bis[(6-chloro-3-pyridinyl)methyl]-2,4-pentanedione, with the CAS number 865658-84-0, is a synthetic organic compound characterized by its complex structure, which includes a pentanedione backbone substituted with two 6-chloro-3-pyridinyl groups. This compound typically exhibits properties associated with diketones, such as the ability to chelate metal ions due to the presence of the diketone functional groups. It may display biological activity, potentially acting as a ligand in coordination chemistry or as a precursor in the synthesis of more complex molecules. The presence of chlorine and pyridine rings suggests that it may have specific interactions in biological systems or materials science applications. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound's unique structure may lend itself to various applications in pharmaceuticals, agrochemicals, or materials development.

Formula: C₁₇H₁₆Cl₂N₂O₂

InChI: InChI=1S/C17H16Cl2N2O2/c1-11(22)17(12(2)23,7-13-3-5-15(18)20-9-13)8-14-4-6-16(19)21-10-14/h3-6,9-10H,7-8H2,1-2H3

InChI key: InChIKey=OKSGHLHTZFNHCC-UHFFFAOYSA-N

SMILES: C(CC=1C=CC(Cl)=NC1)(CC=2C=CC(Cl)=NC2)(C(C)=O)C(C)=O

Synonyms:

• 2,4-Pentanedione, 3,3-bis[(6-chloro-3-pyridinyl)methyl]-
• 3,3-Bis[(6-chloro-3-pyridinyl)methyl]-2,4-pentanedione