
CAS 865659-09-2
:N-[5-[(Dimethylamino)methylene]-5,6-dihydro-6-oxo-4H-cyclopenta[b]thien-4-yl]-2,2,2-trifluoroacetamide
Description:
N-[5-[(Dimethylamino)methylene]-5,6-dihydro-6-oxo-4H-cyclopenta[b]thien-4-yl]-2,2,2-trifluoroacetamide is a synthetic organic compound characterized by its complex structure, which includes a cyclopentathiene moiety and a trifluoroacetamide functional group. This compound features a dimethylamino group that contributes to its potential biological activity, possibly influencing its solubility and reactivity. The presence of trifluoroacetyl enhances its lipophilicity, which may affect its pharmacokinetic properties. The cyclopentathiene ring system is known for its unique electronic properties, which can impart interesting chemical behavior. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and effects would depend on the context of its use, including concentration and the biological system involved. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in research or therapeutic contexts.
Formula:C12H11F3N2O2S
InChI:InChI=1S/C12H11F3N2O2S/c1-17(2)5-7-8(16-11(19)12(13,14)15)6-3-4-20-10(6)9(7)18/h3-5,8H,1-2H3,(H,16,19)
InChI key:InChIKey=CMVMKIWABGOSPV-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1C2=C(C(=O)C1=CN(C)C)SC=C2
Synonyms:- Acetamide, N-[5-[(dimethylamino)methylene]-5,6-dihydro-6-oxo-4H-cyclopenta[b]thien-4-yl]-2,2,2-trifluoro-
- N-[5-[(Dimethylamino)methylene]-5,6-dihydro-6-oxo-4H-cyclopenta[b]thien-4-yl]-2,2,2-trifluoroacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.