CymitQuimica logo

CAS 865659-14-9

:

5-[(3-Fluorophenyl)methoxy]-2-(hydroxymethyl)-4H-pyran-4-one

Description:
5-[(3-Fluorophenyl)methoxy]-2-(hydroxymethyl)-4H-pyran-4-one, with the CAS number 865659-14-9, is a synthetic organic compound characterized by its pyranone structure, which features a pyran ring with a ketone and hydroxymethyl substituent. The presence of a methoxy group attached to a 3-fluorophenyl moiety enhances its chemical reactivity and potential biological activity. This compound may exhibit properties such as antioxidant, anti-inflammatory, or antimicrobial activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the functional groups present. The fluorine atom in the phenyl ring can influence the compound's lipophilicity and biological interactions. Overall, this compound's unique structural features and functional groups contribute to its potential applications in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C13H11FO4
InChI:InChI=1S/C13H11FO4/c14-10-3-1-2-9(4-10)7-18-13-8-17-11(6-15)5-12(13)16/h1-5,8,15H,6-7H2
InChI key:InChIKey=JAZGVUYYWVMRRM-UHFFFAOYSA-N
SMILES:O(CC1=CC(F)=CC=C1)C=2C(=O)C=C(CO)OC2
Synonyms:
  • 4H-Pyran-4-one, 5-[(3-fluorophenyl)methoxy]-2-(hydroxymethyl)-
  • 5-[(3-Fluorophenyl)methoxy]-2-(hydroxymethyl)-4H-pyran-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.