
CAS 865659-15-0
:N-(5-Ethoxy-2,3-dihydro-6-methoxy-3-oxo-1H-inden-1-yl)-2-furancarboxamide
Description:
N-(5-Ethoxy-2,3-dihydro-6-methoxy-3-oxo-1H-inden-1-yl)-2-furancarboxamide, with the CAS number 865659-15-0, is a synthetic organic compound characterized by its complex molecular structure, which includes an indene core and a furan ring. This compound features multiple functional groups, including an amide and ether, contributing to its potential reactivity and biological activity. The presence of the ethoxy and methoxy groups enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific interactions with biological targets would depend on the spatial arrangement of its substituents and the overall conformation of the molecule. As with many synthetic compounds, understanding its stability, reactivity, and potential toxicity is crucial for evaluating its practical applications. Further studies, including pharmacological assessments, would be necessary to elucidate its full potential and safety profile.
Formula:C17H17NO5
InChI:InChI=1S/C17H17NO5/c1-3-22-16-8-11-10(7-15(16)21-2)12(9-13(11)19)18-17(20)14-5-4-6-23-14/h4-8,12H,3,9H2,1-2H3,(H,18,20)
InChI key:InChIKey=XNJAHNGWDNGJEG-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CO1)C2C=3C(=CC(OCC)=C(OC)C3)C(=O)C2
Synonyms:- 2-Furancarboxamide, N-(5-ethoxy-2,3-dihydro-6-methoxy-3-oxo-1H-inden-1-yl)-
- N-(5-Ethoxy-2,3-dihydro-6-methoxy-3-oxo-1H-inden-1-yl)-2-furancarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.