CAS 865659-54-7

N-(3,4-Dimethoxyphenyl)-4-(2,6-dimethylphenyl)-1-piperazinecarboxamide

Description:

N-(3,4-Dimethoxyphenyl)-4-(2,6-dimethylphenyl)-1-piperazinecarboxamide, with the CAS number 865659-54-7, is a synthetic organic compound characterized by its complex structure, which includes a piperazine ring and multiple aromatic substituents. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential biological activity due to its piperazine moiety, which is often found in pharmacologically active compounds. The presence of methoxy groups on the aromatic rings may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the dimethyl substitution on the phenyl ring can affect steric hindrance and electronic properties, potentially impacting its reactivity and binding affinity in biological systems. As a result, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific biological activities and safety profiles would require empirical studies to establish their efficacy and toxicity.

Formula: C₂₁H₂₇N₃O₃

InChI: InChI=1S/C21H27N3O3/c1-15-6-5-7-16(2)20(15)23-10-12-24(13-11-23)21(25)22-17-8-9-18(26-3)19(14-17)27-4/h5-9,14H,10-13H2,1-4H3,(H,22,25)

InChI key: InChIKey=BVHMCPFCVNWOMN-UHFFFAOYSA-N

SMILES: CC1=C(C(C)=CC=C1)N2CCN(C(NC3=CC(OC)=C(OC)C=C3)=O)CC2

Synonyms:

• N-(3,4-Dimethoxyphenyl)-4-(2,6-dimethylphenyl)-1-piperazinecarboxamide
• 1-Piperazinecarboxamide, N-(3,4-dimethoxyphenyl)-4-(2,6-dimethylphenyl)-