
CAS 865659-75-2
:N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-(4-pyridinyl)-1-piperazinecarboxamide
Description:
N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-(4-pyridinyl)-1-piperazinecarboxamide, with CAS number 865659-75-2, is a chemical compound characterized by its complex structure, which includes a benzodioxin moiety and a piperazine ring. This compound typically exhibits properties associated with its functional groups, such as potential solubility in polar solvents due to the presence of the piperazine and carboxamide functionalities. It may also demonstrate biological activity, often explored in medicinal chemistry for its potential therapeutic applications. The presence of the pyridine ring suggests possible interactions with biological targets, making it a candidate for drug development. Additionally, the compound's molecular structure may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion (ADME). As with many synthetic organic compounds, stability, reactivity, and safety profiles are essential considerations in its handling and application. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.
Formula:C18H20N4O3
InChI:InChI=1S/C18H20N4O3/c23-18(20-14-1-2-16-17(13-14)25-12-11-24-16)22-9-7-21(8-10-22)15-3-5-19-6-4-15/h1-6,13H,7-12H2,(H,20,23)
InChI key:InChIKey=SZLPUVODJZTPGP-UHFFFAOYSA-N
SMILES:N(C(=O)N1CCN(CC1)C=2C=CN=CC2)C=3C=C4C(=CC3)OCCO4
Synonyms:- N-(2,3-Dihydro-1,4-benzodioxin-6-yl)-4-(4-pyridinyl)-1-piperazinecarboxamide
- 1-Piperazinecarboxamide, N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(4-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.