CAS 865659-95-6

6H-[1]Benzopyrano[4,3-d]pyrazolo[1,5-a]pyrimidine-11-carbonitrile

Description:

6H-[1]Benzopyrano[4,3-d]pyrazolo[1,5-a]pyrimidine-11-carbonitrile, with the CAS number 865659-95-6, is a heterocyclic compound characterized by its complex fused ring structure, which includes elements of benzopyran, pyrazole, and pyrimidine. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. Its structure suggests the presence of multiple functional groups, which may contribute to its reactivity and interaction with biological targets. The carbonitrile group is notable for its ability to participate in nucleophilic reactions, potentially influencing the compound's pharmacological profile. Additionally, compounds of this type may exhibit fluorescence or other optical properties, depending on their specific electronic structure. Research into such compounds often focuses on their potential applications in drug development, particularly in targeting specific enzymes or receptors due to their structural diversity and ability to form hydrogen bonds. Overall, 6H-[1]Benzopyrano[4,3-d]pyrazolo[1,5-a]pyrimidine-11-carbonitrile represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₄H₈N₄O

InChI: InChI=1S/C14H8N4O/c15-5-9-6-16-18-7-10-8-19-12-4-2-1-3-11(12)13(10)17-14(9)18/h1-4,6-7H,8H2

InChI key: InChIKey=AJAZCYDEANMXSB-UHFFFAOYSA-N

SMILES: C(#N)C1=C2N=C3C=4C(OCC3=CN2N=C1)=CC=CC4

Synonyms:

• 6H-Chromeno[4,3-d]pyrazolo[1,5-a]pyrimidine-11-carbonitrile
• 6H-[1]Benzopyrano[4,3-d]pyrazolo[1,5-a]pyrimidine-11-carbonitrile