CAS 865660-59-9

5-(2-Amino-4-thiazolyl)-2,2-dimethyl-1,3-dioxane-4,6-dione

Description:

5-(2-Amino-4-thiazolyl)-2,2-dimethyl-1,3-dioxane-4,6-dione, identified by its CAS number 865660-59-9, is a synthetic organic compound characterized by its unique structural features, including a dioxane ring and a thiazole moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for compounds containing amino and carbonyl functional groups. The presence of the thiazole ring suggests potential biological activity, as thiazoles are often found in pharmacologically active compounds. The dioxane structure contributes to its stability and may influence its reactivity, particularly in nucleophilic substitution reactions. Additionally, the dimethyl groups enhance steric hindrance, which can affect the compound's interactions with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization.

Formula: C₉H₁₀N₂O₄S

InChI: InChI=1S/C9H10N2O4S/c1-9(2)14-6(12)5(7(13)15-9)4-3-16-8(10)11-4/h3,5H,1-2H3,(H2,10,11)

InChI key: InChIKey=HNLMKHZTFVMTNB-UHFFFAOYSA-N

SMILES: O=C1C(C2=CSC(N)=N2)C(=O)OC(C)(C)O1

Synonyms:

• 1,3-Dioxane-4,6-dione, 5-(2-amino-4-thiazolyl)-2,2-dimethyl-
• 5-(2-Amino-4-thiazolyl)-2,2-dimethyl-1,3-dioxane-4,6-dione