CAS 86569-49-5

N-(2-amino-4-chlorophenyl)-2-methylpropanamide

Description:

N-(2-amino-4-chlorophenyl)-2-methylpropanamide, with the CAS number 86569-49-5, is a chemical compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This compound features a chlorinated aromatic ring, specifically a 4-chloro substitution on a phenyl group, which can influence its reactivity and biological activity. The presence of the amino group suggests potential for hydrogen bonding, enhancing solubility in polar solvents. The 2-methylpropanamide structure contributes to its steric properties, potentially affecting its interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, including acylation and nucleophilic substitution. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in research or industry.

Formula: C₁₀H₁₃ClN₂O

InChI: InChI=1/C10H13ClN2O/c1-6(2)10(14)13-9-4-3-7(11)5-8(9)12/h3-6H,12H2,1-2H3,(H,13,14)

SMILES: CC(C)C(=Nc1ccc(cc1N)Cl)O

N-(2-Amino-4-chlorophenyl)isobutyramide

CAS: 86569-49-5

N-(2-Amino-4-chlorophenyl)isobutyramide

Purity: 95%

Molecular weight: 212.68g/mol

Ref: 54-OR1054374