CymitQuimica logo

CAS 865701-97-9

:

prop-2-en-1-yl 3-bromo-N-(tert-butoxycarbonyl)alaninate

Description:
Prop-2-en-1-yl 3-bromo-N-(tert-butoxycarbonyl)alaninate, with the CAS number 865701-97-9, is a chemical compound that features a propenyl group, a bromine atom, and a tert-butoxycarbonyl (Boc) protecting group attached to an alanine derivative. This compound is characterized by its functional groups, which include an alkene (the prop-2-en-1-yl moiety), a halogen (bromine), and an amine (from the alanine structure). The presence of the Boc group indicates that this compound is likely used in peptide synthesis or as an intermediate in organic synthesis, providing protection for the amine during reactions. The compound is typically a solid or liquid at room temperature, depending on its purity and specific formulation. Its reactivity is influenced by the alkene and bromine functionalities, making it suitable for various chemical transformations, including nucleophilic substitutions and polymerization reactions. Safety precautions should be taken when handling this compound, as it may pose hazards typical of brominated organic compounds.
Formula:C11H18BrNO4
InChI:InChI=1/C11H18BrNO4/c1-5-6-16-9(14)8(7-12)13-10(15)17-11(2,3)4/h5,8H,1,6-7H2,2-4H3,(H,13,15)
SMILES:C=CCOC(=O)C(CBr)N=C(O)OC(C)(C)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.