CAS 86581-30-8
:7-fluorohexadecanoic acid
Description:
7-Fluorohexadecanoic acid, with the CAS number 86581-30-8, is a fluorinated fatty acid characterized by the presence of a fluorine atom at the seventh carbon position of a hexadecanoic acid (palmitic acid) chain. This compound typically exhibits properties similar to other long-chain fatty acids, such as being a solid at room temperature and having a relatively high melting point due to its long hydrocarbon chain. The introduction of the fluorine atom can influence its chemical reactivity, solubility, and biological activity, potentially enhancing lipophilicity and altering membrane interactions. Fluorinated fatty acids are of interest in various fields, including medicinal chemistry and materials science, due to their unique properties. Additionally, the presence of the fluorine atom may impart antimicrobial or anti-inflammatory properties, making it a subject of research in pharmaceutical applications. Overall, 7-fluorohexadecanoic acid represents a unique class of compounds that combine the characteristics of fatty acids with the distinct properties of fluorinated molecules.
Formula:C16H31FO2
InChI:InChI=1/C16H31FO2/c1-2-3-4-5-6-7-9-12-15(17)13-10-8-11-14-16(18)19/h15H,2-14H2,1H3,(H,18,19)
SMILES:CCCCCCCCCC(CCCCCC(=O)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.