CAS 865860-80-6
:ethenyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate
Description:
Ethenyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate, identified by its CAS number 865860-80-6, is an organic compound characterized by its unique structure that includes a dioxane ring and a carboxylate functional group. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic dioxane ring. The presence of the ethenyl group suggests that it may participate in polymerization reactions, making it useful in various synthetic applications. Additionally, the trimethyl substitution on the dioxane ring can influence its reactivity and stability, potentially enhancing its resistance to hydrolysis. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested. Overall, ethenyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate is a versatile compound with potential applications in chemical synthesis and materials science.
Formula:C10H16O4
InChI:InChI=1/C10H16O4/c1-5-12-8(11)10(4)6-13-9(2,3)14-7-10/h5H,1,6-7H2,2-4H3
SMILES:C=COC(=O)C1(C)COC(C)(C)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2,5-Trimethyl-1,3-dioxane-5-carboxylic Acid Ethenyl Ester
CAS:Controlled Product<p>Applications 2,2,5-Trimethyl-1,3-dioxane-5-carboxylic Acid Ethenyl Ester (cas# 865860-80-6) is a compound useful in organic synthesis.<br></p>Formula:C10H16O4Color and Shape:NeatMolecular weight:200.23
