CymitQuimica logo

CAS 865879-00-1

:

4-(aminomethyl)-2-fluoroaniline hydrochloride

Description:
4-(Aminomethyl)-2-fluoroaniline hydrochloride is a chemical compound characterized by its amine and fluoro substituents on an aromatic ring. It features an amino group (-NH2) attached to a methylene (-CH2-) group, which is further connected to a fluorinated aromatic ring, specifically a fluorine atom at the 2-position of the aniline structure. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and makes it easier to handle in various applications. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The presence of both the amino and fluoro groups can influence the compound's reactivity, polarity, and potential biological activity. Additionally, the hydrochloride form can affect the compound's stability and storage conditions. As with many amine-containing compounds, it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as with all chemicals, due to potential toxicity and reactivity.
Formula:C7H10ClFN2
InChI:InChI=1/C7H9FN2.ClH/c8-6-3-5(4-9)1-2-7(6)10;/h1-3H,4,9-10H2;1H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.