CAS 865887-05-4

7-Bromo-4-methoxy-1H-indazole-3-carboxylic acid

Description:

7-Bromo-4-methoxy-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 7-position and a methoxy group at the 4-position contributes to its unique reactivity and potential biological activity. The carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the substituents on the indazole ring, making it a valuable candidate for further research in synthetic and medicinal chemistry.

Formula: C₉H₇BrN₂O₃

InChI: InChI=1S/C9H7BrN2O3/c1-15-5-3-2-4(10)7-6(5)8(9(13)14)12-11-7/h2-3H,1H3,(H,11,12)(H,13,14)

InChI key: InChIKey=NRMOGNFZLYYFSJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(=C(Br)C=CC2OC)NN1

Synonyms:

• 7-Bromo-4-methoxy-1H-indazole-3-carboxylic acid
• 1H-Indazole-3-carboxylic acid, 7-bromo-4-methoxy-