CymitQuimica logo

CAS 865887-11-2

:

6-benzyloxy-1H-indazole-3-carboxylic acid

Description:
6-Benzyloxy-1H-indazole-3-carboxylic acid is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a benzyloxy group at the 6-position enhances its solubility and may influence its biological activity. The carboxylic acid functional group at the 3-position contributes to its acidity and potential reactivity, making it suitable for various chemical reactions, including esterification and amidation. This compound may exhibit interesting pharmacological properties, as many indazole derivatives are known for their biological activities, including anti-inflammatory and anticancer effects. Its molecular structure allows for potential interactions with biological targets, making it a candidate for drug development. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and solvent conditions. Overall, 6-benzyloxy-1H-indazole-3-carboxylic acid represents a versatile scaffold in medicinal chemistry, with potential applications in therapeutic research and development.
Formula:C15H12N2O3
InChI:InChI=1/C15H12N2O3/c18-15(19)14-12-7-6-11(8-13(12)16-17-14)20-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,17)(H,18,19)
InChI key:JBPCEKWXGCHLSX-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COc1ccc2c(c1)[nH]nc2C(=O)O
Synonyms:
  • 1H-indazole-3-carboxylic acid, 6-(phenylmethoxy)-
  • 6-(Benzyloxy)-1H-indazole-3-carboxylic acid
Found 3 products.