CAS 865887-14-5

1-Azabicyclo[2.2.2]octane-3-methanamine, hydrochloride (1:2)

Description:

1-Azabicyclo[2.2.2]octane-3-methanamine, hydrochloride (1:2) is a bicyclic amine characterized by its unique structure, which includes a bicyclic framework and a methanamine functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The bicyclic structure contributes to its potential biological activity, as it can interact with various receptors in the central nervous system. The presence of the amine group allows for hydrogen bonding, which can influence its pharmacokinetic properties, such as absorption and distribution. Additionally, the hydrochloride form stabilizes the compound and facilitates its handling and formulation in pharmaceutical contexts. Overall, this compound's structural features suggest potential utility in drug development, particularly in the context of neuropharmacological agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₈H₁₆N₂·2ClH

InChI: InChI=1S/C8H16N2.2ClH/c9-5-8-6-10-3-1-7(8)2-4-10;;/h7-8H,1-6,9H2;2*1H

InChI key: InChIKey=IWUXYDCAXVQVRL-UHFFFAOYSA-N

SMILES: C(N)C1C2CCN(C1)CC2.Cl

Synonyms:

• [1-Azabicyclo[2.2.2]octan-3-yl]methanamine dihydrochloride
• 1-Azabicyclo[2.2.2]octane-3-methanamine, hydrochloride (1:2)
• 1-Azabicyclo[2.2.2]octane-3-methanamine, dihydrochloride

{1-Azabicyclo[2.2.2]octan-3-yl}methanamine dihydrochloride

CAS: 865887-14-5

Versatile small molecule scaffold

Formula: C₈H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 213.15 g/mol

Ref: 3D-QJB88714