CAS 86594-16-3
:(4R)-3-Nitroso-4-thiazolidinecarboxylic acid
Description:
(4R)-3-Nitroso-4-thiazolidinecarboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a nitroso group and a carboxylic acid functional group. This compound is typically a solid at room temperature and exhibits properties associated with both thiazolidine derivatives and nitroso compounds. The presence of the nitroso group can impart unique reactivity, particularly in terms of its ability to participate in various chemical reactions, such as nucleophilic attacks or redox processes. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. Additionally, the stereochemistry indicated by the (4R) designation suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. Overall, (4R)-3-Nitroso-4-thiazolidinecarboxylic acid may have applications in medicinal chemistry or as a reagent in organic synthesis, although specific applications would depend on further research into its properties and reactivity.
Formula:C4H6N2O3S
InChI:InChI=1S/C4H6N2O3S/c7-4(8)3-1-10-2-6(3)5-9/h3H,1-2H2,(H,7,8)/t3-/m0/s1
InChI key:InChIKey=LGLMHMRNPVACGS-VKHMYHEASA-N
SMILES:N(=O)N1[C@H](C(O)=O)CSC1
Synonyms:- (4R)-3-Nitroso-4-thiazolidinecarboxylic acid
- 4-Thiazolidinecarboxylic acid, 3-nitroso-, (R)-
- (4R)-3-Nitroso-1,3-thiazolidine-4-carboxylic acid
- N-Nitroso-L-thioproline
- 4-Thiazolidinecarboxylic acid, 3-nitroso-, (4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(4R)-N-Nitroso Thiazolidine-4-carboxylic Acid
CAS:Controlled ProductApplications A chiral N-nitroso compound formed in smoke food (smoked bacon, smoked Swiss cheese, smoke flavoring). A carcinogenic compound.
References Lu, S, et al.: Cancer Res., 46, 1485 (1986), Ikins, W.G., et al.: Food Chem. Toxicol., 26, 15 (1988), Kodama, M., et al.: Anticancer Res. 12, 1671 (1992), Ferguson, L., et al.: Mutat Res., 443, 1 (1999),Formula:C4H6N2O3SColor and Shape:NeatMolecular weight:162.17


