CAS 86594-16-3: (4R)-3-Nitroso-4-thiazolidinecarboxylic acid

Description:(4R)-3-Nitroso-4-thiazolidinecarboxylic acid is a chemical compound characterized by its thiazolidine ring structure, which incorporates a nitroso group and a carboxylic acid functional group. This compound is typically a solid at room temperature and exhibits properties associated with both thiazolidine derivatives and nitroso compounds. The presence of the nitroso group can impart unique reactivity, particularly in terms of its ability to participate in various chemical reactions, such as nucleophilic attacks or redox processes. The carboxylic acid group contributes to its acidity and potential for forming salts or esters. Additionally, the stereochemistry indicated by the (4R) designation suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. Overall, (4R)-3-Nitroso-4-thiazolidinecarboxylic acid may have applications in medicinal chemistry or as a reagent in organic synthesis, although specific applications would depend on further research into its properties and reactivity.

Formula:C₄H₆N₂O₃S

InChI:InChI=1S/C4H6N2O3S/c7-4(8)3-1-10-2-6(3)5-9/h3H,1-2H2,(H,7,8)/t3-/m0/s1

InChI key:InChIKey=LGLMHMRNPVACGS-VKHMYHEASA-N

SMILES:O=NN1CSCC1C(=O)O

Synonyms:
(4R)-3-Nitroso-4-thiazolidinecarboxylic acid
4-Thiazolidinecarboxylic acid, 3-nitroso-, (R)-
(4R)-3-Nitroso-1,3-thiazolidine-4-carboxylic acid
N-Nitroso-L-thioproline
4-Thiazolidinecarboxylic acid, 3-nitroso-, (4R)-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
(4R)-N-Nitroso Thiazolidine-4-carboxylic Acid REF: 4Z-N-103007CAS: 86594-16-3	- - -	298.00 €~1,230.00 €	Tue 06 May 25
(4R)-N-Nitroso Thiazolidine-4-carboxylic Acid REF: TR-N546755CAS: 86594-16-3	- - -	340.00 €~2,164.00 €	Tue 13 May 25
(4R)-N-Nitroso thiazolidine-4-carboxylic acid REF: 3D-LDA59416CAS: 86594-16-3	Min. 95%	- - -	Discontinued product