
CAS 86595-33-7
:Boronic acid, (1-methylpropyl)-, bis(1-methylethyl) ester
Description:
Boronic acid, (1-methylpropyl)-, bis(1-methylethyl) ester, identified by CAS number 86595-33-7, is an organoboron compound characterized by the presence of a boron atom bonded to a boronic acid functional group and two alkyl ester groups. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents, making it useful in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The presence of the boron atom allows for the formation of reversible covalent bonds with diols, which is a key feature in applications such as drug development and materials science. Additionally, the branched alkyl groups contribute to its steric properties, influencing its reactivity and interaction with other molecules. Boronic acids are known for their role in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in the synthesis of complex organic molecules. Overall, this compound's unique structure and reactivity make it a valuable tool in synthetic organic chemistry.
Formula:C10H23BO2
InChI:InChI=1S/C10H23BO2/c1-7-10(6)11(12-8(2)3)13-9(4)5/h8-10H,7H2,1-6H3
InChI key:InChIKey=XFZIDDFTTVBEMX-UHFFFAOYSA-N
SMILES:B(C(CC)C)(OC(C)C)OC(C)C
Synonyms:- sec-Butyldiisopropoxyborane
- Boronic acid, (1-methylpropyl)-, bis(1-methylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Boronic acid, (1-methylpropyl)-, bis(1-methylethyl) ester
CAS:Formula:C10H23BO2Molecular weight:186.0994
