CymitQuimica logo

CAS 86595-38-2

:

Boronic acid, hexyl-, diethyl ester

Description:
Boronic acid, hexyl-, diethyl ester, with the CAS number 86595-38-2, is an organoboron compound characterized by the presence of a boron atom bonded to a hexyl group and two ethyl ester groups. This compound typically exhibits a polar nature due to the presence of the boron atom and the ester functional groups, which can influence its solubility in various solvents. Boronic acids and their esters are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and materials science. The hexyl group contributes to the hydrophobic character of the molecule, potentially affecting its reactivity and interaction with other substances. Additionally, boronic esters can participate in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds in organic chemistry. Overall, this compound's unique structure and functional properties make it a useful intermediate in various chemical applications, including pharmaceuticals and agrochemicals.
Formula:C10H23BO2
InChI:InChI=1S/C10H23BO2/c1-4-7-8-9-10-11(12-5-2)13-6-3/h4-10H2,1-3H3
InChI key:InChIKey=JPUWPFAUCZEFGB-UHFFFAOYSA-N
SMILES:B(CCCCCC)(OCC)OCC
Synonyms:
  • Boronic acid, hexyl-, diethyl ester
  • 1-Hexaneboronic acid, diethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.