CAS 865980-54-7
:4-aminotricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid
Description:
4-Aminotricyclo[3.3.1.1^3,7]decane-1-carboxylic acid is a bicyclic organic compound characterized by its unique tricyclic structure, which includes a carboxylic acid functional group and an amino group. This compound features a rigid framework that contributes to its potential biological activity and interaction with various receptors. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. The carboxylic acid group can donate protons, making it an acid and allowing it to engage in acid-base reactions. Its structural complexity may lead to interesting stereochemical properties, which can affect its pharmacological profile. The compound is of interest in medicinal chemistry and may have applications in drug development due to its potential interactions with biological targets. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, 4-aminotricyclo[3.3.1.1^3,7]decane-1-carboxylic acid exemplifies the intricate relationship between molecular structure and chemical behavior.
Formula:C11H17NO2
InChI:InChI=1/C11H17NO2/c12-9-7-1-6-2-8(9)5-11(3-6,4-7)10(13)14/h6-9H,1-5,12H2,(H,13,14)
SMILES:C1C2CC3CC(C2)(CC1C3N)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(1S,3R,5S,7s)-methyl 4-aminoadamantane-1-carboxylate
CAS:Formula:C12H19NO2Purity:97%Color and Shape:SolidMolecular weight:209.28484-Amino-1-adamantanecarboxylic acid
CAS:4-Amino-1-adamantanecarboxylic acid is a useful building block for the synthesis of 4-aminopyridine and 4-aminopyrimidine derivatives. It is an important intermediate in the production of speciality chemicals and has been used as a reaction component in organic synthesis. This compound is also used as a reagent for chemical reactions.Formula:C12H19NO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:209.28 g/mol


