CymitQuimica logo

CAS 865980-55-8

:

4-Aminotricyclo[3.3.1.13,7]decane-1-methanol

Description:
4-Aminotricyclo[3.3.1.1^3,7]decane-1-methanol, with the CAS number 865980-55-8, is a bicyclic organic compound characterized by its unique tricyclic structure, which includes a primary amine and a hydroxymethyl group. This compound features a nitrogen atom in its structure, contributing to its basicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the hydroxymethyl group enhances its polarity, making it more soluble in polar solvents. The tricyclic framework provides rigidity, which can affect its conformational properties and interactions with biological targets. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its synthesis and characterization involve standard organic chemistry techniques, and it may serve as a precursor or intermediate in the development of more complex molecules. Overall, 4-Aminotricyclo[3.3.1.1^3,7]decane-1-methanol represents a fascinating example of a compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H19NO
InChI:InChI=1S/C11H19NO/c12-10-8-1-7-2-9(10)5-11(3-7,4-8)6-13/h7-10,13H,1-6,12H2
InChI key:InChIKey=QFKQPWVSSXAIRC-UHFFFAOYSA-N
SMILES:C(O)C12CC3C(N)C(C1)CC(C2)C3
Synonyms:
  • (4-Aminoadamantan-1-yl)methanol
  • Tricyclo[3.3.1.13,7]decane-1-methanol, 4-amino-
  • 4-Aminotricyclo[3.3.1.13,7]decane-1-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.