CAS 866-05-7
:bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) carbonate
Description:
Bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) carbonate, with CAS number 866-05-7, is a fluorinated organic compound characterized by its unique structure, which includes a carbonate functional group bonded to two dodecafluoroheptyl groups. This compound is notable for its high thermal and chemical stability, making it suitable for various applications in the fields of materials science and chemical engineering. The presence of multiple fluorine atoms contributes to its hydrophobic and lipophobic properties, enhancing its resistance to degradation and making it useful in coatings and surfactants. Additionally, its low surface energy can lead to applications in non-stick and water-repellent materials. The compound is typically synthesized through specific fluorination and carbonate formation reactions, and it is important to handle it with care due to potential environmental and health impacts associated with fluorinated compounds. Overall, bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) carbonate exemplifies the unique properties of fluorinated chemicals, combining stability with specialized functional characteristics.
Formula:C15H6F24O3
InChI:InChI=1/C15H6F24O3/c16-3(17)8(24,25)12(32,33)14(36,37)10(28,29)6(20,21)1-41-5(40)42-2-7(22,23)11(30,31)15(38,39)13(34,35)9(26,27)4(18)19/h3-4H,1-2H2
SMILES:C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)OC(=O)OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bis(1H,1H,7H-perfluoroheptyl) carbonate
CAS:<p>Bis(1H,1H,7H-perfluoroheptyl) carbonate</p>Molecular weight:690.17g/mol
